Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Sarafloxacin hydrochloride is a fluoroquinolone antibacterial agent. Inhibits bacterial DNA gyrase (topoisomerase). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11659 |
|---|---|
| Formula | C20H17F2N3O3.HCl |
| Molecular Weight | 421.83 |
| CAS Number | 91296-87-6 |
| SMILES | C1CN(CCN1)C2=C(C=C3C(=C2)N(C=C(C3=O)C(=O)O)C4=CC=C(C=C4)F)F.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 4 mg/mL (9.48 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.71 mL | 118.53 mL | 237.06 mL |
| 0.5 mM | 4.74 mL | 23.71 mL | 47.41 mL |
| 1 mM | 2.37 mL | 11.85 mL | 23.71 mL |
| 5 mM | 0.47 mL | 2.37 mL | 4.74 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
