Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SB 743921, a second generation KSP inhibitor, is a highly potent and active therapeutic in preclinical models of cancer. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10828 |
|---|---|
| Formula | C31H33N2O3.HCl |
| Molecular Weight | 553.5 |
| CAS Number | 940929-33-9 |
| SMILES | CC1=CC=C(C=C1)C(=O)N(CCCN)[C@@H](C2=C(C(=O)C3=C(O2)C=C(C=C3)Cl)CC4=CC=CC=C4)C(C)C.Cl |
| Synonyms | SB-743921, SB743921 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 103 mg/mL (186.08 mM) | |
| Water | 20 mg/mL (36.13 mM) | ||
| Ethanol | 103 mg/mL (186.08 mM) | ||
| In vivo | Saline pH5.0 | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.07 mL | 90.33 mL | 180.67 mL |
| 0.5 mM | 3.61 mL | 18.07 mL | 36.13 mL |
| 1 mM | 1.81 mL | 9.03 mL | 18.07 mL |
| 5 mM | 0.36 mL | 1.81 mL | 3.61 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
