Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SCH527123 is a potent and selective antagonist of the human CXCR1 and CXCR2 receptors with IC50 of 42 nM and 3 nM, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11555 |
|---|---|
| Formula | C21H23N3O5 |
| Molecular Weight | 397.42 |
| CAS Number | 473727-83-2 |
| SMILES | CC[C@H](C1=CC=C(O1)C)NC2=C(C(=O)C2=O)NC3=CC=CC(=C3O)C(=O)N(C)C |
| Synonyms | SCH 527123, SCH527123 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 71 mg/mL (178.65 mM) | |
| Water | Insoluble | ||
| Ethanol | 71 mg/mL (178.65 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.16 mL | 125.81 mL | 251.62 mL |
| 0.5 mM | 5.03 mL | 25.16 mL | 50.32 mL |
| 1 mM | 2.52 mL | 12.58 mL | 25.16 mL |
| 5 mM | 0.5 mL | 2.52 mL | 5.03 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
