Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Schisantherin A is a dibenzocyclooctadiene that exhibits anti-tussive, sedative, anti-inflammatory, anti-osteoporotic, neuroprotective, cognition enhancing, and cardioprotective activities. In macrophages, Gomisin C decreases LPS-induced expression and activity of iNOS, COX-2, NO, IL-6, and TNF-??. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14784 |
|---|---|
| Formula | C30H32O9 |
| Molecular Weight | 536.57 |
| CAS Number | 58546-56-8 |
| SMILES | CC1CC2=CC3=C(C(=C2C4=C(C(=C(C=C4C(C1(C)O)OC(=O)C5=CC=CC=C5)OC)OC)OC)OC)OCO3 |
| Synonyms | Gomisin C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 94 mg/mL (175.18 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.64 mL | 93.18 mL | 186.37 mL |
| 0.5 mM | 3.73 mL | 18.64 mL | 37.27 mL |
| 1 mM | 1.86 mL | 9.32 mL | 18.64 mL |
| 5 mM | 0.37 mL | 1.86 mL | 3.73 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
