Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Scutellarin is a flavonoid that exhibits a number of cardio- and neuro-protective effects. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12117 |
|---|---|
| Formula | C21H18O12 |
| Molecular Weight | 462.36 |
| CAS Number | 27740-01-8 |
| SMILES | C1=CC(=CC=C1C2=CC(=O)C3=C(C(=C(C=C3O2)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)C(=O)O)O)O)O)O)O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 50 mg/mL (108.14 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.63 mL | 108.14 mL | 216.28 mL |
| 0.5 mM | 4.33 mL | 21.63 mL | 43.26 mL |
| 1 mM | 2.16 mL | 10.81 mL | 21.63 mL |
| 5 mM | 0.43 mL | 2.16 mL | 4.33 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
