Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Specnuezhenide, extracted from dried ripe fruit of Ligustum lucidum Ait privet . |
|---|
| Catalog Num | A14695 |
|---|---|
| Formula | C31H42O17 |
| Molecular Weight | 686.66 |
| CAS Number | 39011-92-2 |
| SMILES | CC=C1C(C(=COC1OC2C(C(C(C(O2)CO)O)O)O)C(=O)OC)CC(=O)OCC3C(C(C(C(O3)OCCC4=CC=C(C=C4)O)O)O)O |
| Synonyms | Nuezhenide |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 91 mg/mL (132.52 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 14.56 mL | 72.82 mL | 145.63 mL |
| 0.5 mM | 2.91 mL | 14.56 mL | 29.13 mL |
| 1 mM | 1.46 mL | 7.28 mL | 14.56 mL |
| 5 mM | 0.29 mL | 1.46 mL | 2.91 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
