Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | STF-62247 is a small molecule agonist that induces autophagy and selectively causes lethality in renal cell carcinoma (RCC) cells that have lost the von Hippel-Lindau (VHL) tumor suppressor activity (IC50 = 625 nM). |
|---|
| Catalog Num | A10866 |
|---|---|
| Formula | C15H13N3S |
| Molecular Weight | 267.4 |
| CAS Number | 315702-99-9 |
| SMILES | CC1=CC(=CC=C1)NC2=NC(=CS2)C3=CC=NC=C3 |
| Synonyms | STF62247 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 47 mg/mL (175.8 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (11.22 mM) | ||
| In vivo | 1% DMSO+30% polyethylene glycol+1% Tween 80 | 6 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.4 mL | 186.99 mL | 373.97 mL |
| 0.5 mM | 7.48 mL | 37.4 mL | 74.79 mL |
| 1 mM | 3.74 mL | 18.7 mL | 37.4 mL |
| 5 mM | 0.75 mL | 3.74 mL | 7.48 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
