Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Stigmasterol, which is readily obtainable from soybean oil, can be transformed easily to progesterone and to other hormones. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10867 |
|---|---|
| Formula | C29H48O |
| Molecular Weight | 412.7 |
| CAS Number | 83-48-7 |
| SMILES | CC[C@H](/C=C/[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C)C(C)C |
| Synonyms | Stigmasterin, Beta-Stigmasterol |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | Insoluble | ||
| Ethanol | Warmed: 2 mg/mL (4.84 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.23 mL | 121.15 mL | 242.31 mL |
| 0.5 mM | 4.85 mL | 24.23 mL | 48.46 mL |
| 1 mM | 2.42 mL | 12.12 mL | 24.23 mL |
| 5 mM | 0.48 mL | 2.42 mL | 4.85 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
