Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Tandutinib (MLN518) inhibits the autophosphorylation of FLT3, c-KIT and PDGF receptor tyrosine kinases, thereby inhibiting cellular proliferation and inducing apoptosis. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10887 |
|---|---|
| Formula | C31H42N6O4 |
| Molecular Weight | 562.7 |
| CAS Number | 387867-13-2 |
| SMILES | CC(C)OC1=CC=C(C=C1)NC(=O)N2CCN(CC2)C3=NC=NC4=CC(=C(C=C43)OC)OCCCN5CCCCC5 |
| Synonyms | MLN-518, CT53518 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 5 mg/mL (8.88 mM) | |
| Water | Insoluble | ||
| Ethanol | 6 mg/mL (10.66 mM) | ||
| In vivo | 0.5% methylcellulose | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.77 mL | 88.86 mL | 177.71 mL |
| 0.5 mM | 3.55 mL | 17.77 mL | 35.54 mL |
| 1 mM | 1.78 mL | 8.89 mL | 17.77 mL |
| 5 mM | 0.36 mL | 1.78 mL | 3.55 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
