Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Telmisartan is an angiotensin II receptor antagonist that inhibits the angiotensin II AT1 receptor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10905 |
|---|---|
| Formula | C33H30N4O2 |
| Molecular Weight | 514.62 |
| CAS Number | 144701-48-4 |
| SMILES | CCCC1=NC2=C(C=C(C=C2N1CC3=CC=C(C=C3)C4=CC=CC=C4C(=O)O)C5=NC6=CC=CC=C6N5C)C |
| Synonyms | BIBR 277;Micardis;Pritor;Telday |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 12 mg/mL (23.32 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.43 mL | 97.16 mL | 194.32 mL |
| 0.5 mM | 3.89 mL | 19.43 mL | 38.86 mL |
| 1 mM | 1.94 mL | 9.72 mL | 19.43 mL |
| 5 mM | 0.39 mL | 1.94 mL | 3.89 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
