Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Tenofovir is in a class of medications called nucleoside reverse transcriptase inhibitors (NRTIs). It works by decreasing the amount of HIV in the blood. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10908 |
|---|---|
| Formula | C9H14N5O4P |
| Molecular Weight | 287.2 |
| CAS Number | 147127-20-6 |
| SMILES | C[C@H](CN1C=NC2=C1N=CN=C2N)OCP(=O)(O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 4 mg/mL (13.92 mM) | |
| Water | 2 mg/mL (6.96 mM) | ||
| Ethanol | Insoluble | ||
| In vivo | 30% propylene glycol, 5% Tween 80, 65% D5W | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.82 mL | 174.09 mL | 348.19 mL |
| 0.5 mM | 6.96 mL | 34.82 mL | 69.64 mL |
| 1 mM | 3.48 mL | 17.41 mL | 34.82 mL |
| 5 mM | 0.7 mL | 3.48 mL | 6.96 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
