Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Torcetrapib (CP-529414) is a CETP inhibitor with IC50 of 37 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11242 |
|---|---|
| Formula | C26H25F9N2O4 |
| Molecular Weight | 600.47 |
| CAS Number | 262352-17-0 |
| SMILES | CC[C@@H]1C[C@@H](C2=C(N1C(=O)OCC)C=CC(=C2)C(F)(F)F)N(CC3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F)C(=O)OC |
| Synonyms | CP-529414, CP529414, CP 529414 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 106 mg/mL (176.53 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL (8.33 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.65 mL | 83.27 mL | 166.54 mL |
| 0.5 mM | 3.33 mL | 16.65 mL | 33.31 mL |
| 1 mM | 1.67 mL | 8.33 mL | 16.65 mL |
| 5 mM | 0.33 mL | 1.67 mL | 3.33 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
