Signaling Pathway
Product type
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | TWS119 is a 4,6 disubstituted pyrrolopyrimidine that potently inhibits GSK3β with an IC50 value of 30 nM.1 At 400 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11223 |
|---|---|
| Formula | C18H14N4O2 |
| Molecular Weight | 318.3 |
| CAS Number | 601514-19-6 |
| SMILES | C1=CC(=CC(=C1)N)C2=CC3=C(N2)N=CN=C3OC4=CC=CC(=C4)O |
| Synonyms | TWS-119 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 58 mg/mL (182.19 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 1% DMSO+30% polyethylene glycol+1% Tween 80 | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.42 mL | 157.08 mL | 314.17 mL |
| 0.5 mM | 6.28 mL | 31.42 mL | 62.83 mL |
| 1 mM | 3.14 mL | 15.71 mL | 31.42 mL |
| 5 mM | 0.63 mL | 3.14 mL | 6.28 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
