Signaling Pathway
Product type
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Volitinib is an orally bioavailable inhibitor of the c-Met receptor tyrosine kinase with potential antineoplastic activity. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A14419 |
|---|---|
| Formula | C17H15N9 |
| Molecular Weight | 345.36 |
| CAS Number | 1313725-88-0 |
| SMILES | C[C@@H](C1=CN2C=CN=C2C=C1)N3C4=NC(=CN=C4N=N3)C5=CN(N=C5)C |
| Synonyms | HMPL-504, HMPL504, HMPL504, AZD-6094, AZD 6094, AZD6094 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 14 mg/mL (40.53 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.96 mL | 144.78 mL | 289.55 mL |
| 0.5 mM | 5.79 mL | 28.96 mL | 57.91 mL |
| 1 mM | 2.9 mL | 14.48 mL | 28.96 mL |
| 5 mM | 0.58 mL | 2.9 mL | 5.79 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
