Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | WHI-P97 is a rationally designed potent inhibitor of JAK-3. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11608 |
|---|---|
| Formula | C16H13Br2N3O3 |
| Molecular Weight | 455.11 |
| CAS Number | 211555-05-4 |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=C(C(=C3)Br)O)Br)OC |
| Synonyms | WHI-P-97, WHI P97 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 7 mg/mL (15.37 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.97 mL | 109.86 mL | 219.73 mL |
| 0.5 mM | 4.39 mL | 21.97 mL | 43.95 mL |
| 1 mM | 2.2 mL | 10.99 mL | 21.97 mL |
| 5 mM | 0.44 mL | 2.2 mL | 4.39 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
