Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Y320 is an orally active immunomodulator, and inhibits IL-17 production by CD4 T cells stimulated with IL-15 with IC50 of 20 to 60 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11963 |
|---|---|
| Formula | C27H29ClN6O2 |
| Molecular Weight | 505.01 |
| CAS Number | 288250-47-5 |
| SMILES | CC1=C(C=NN1C2=CC=C(C=C2)Cl)C(=O)NC3=CC(=C(C=C3)N4CCC(CC4)N5CCOCC5)C#N |
| Synonyms | Y-320 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 10 mg/mL (19.8 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.8 mL | 99.01 mL | 198.02 mL |
| 0.5 mM | 3.96 mL | 19.8 mL | 39.6 mL |
| 1 mM | 1.98 mL | 9.9 mL | 19.8 mL |
| 5 mM | 0.4 mL | 1.98 mL | 3.96 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
