AC220 (Quizartinib) is a uniquely potent and selective FLT3 inhibitor with IC50 of 0.56±0.3 nM and >10 mM for MC4-11 and A375, respectively.
Loading distributor info...
| Description | AC220 (Quizartinib) is a uniquely potent and selective FLT3 inhibitor with IC50 of 0.56±0.3 nM and >10 mM for MC4-11 and A375, respectively. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A10027 |
|---|---|
| Formula | C29H32N6O4S |
| Molecular Weight | 560.7 |
| CAS Number | 950769-58-1 |
| SMILES | CC(C)(C)C1=CC(=NO1)NC(=O)NC2=CC=C(C=C2)C3=CN4C5=C(C=C(C=C5)OCCN6CCOCC6)SC4=N3 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 29 mg/mL (51.72 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 15% Captisol | 28 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.83 mL | 89.17 mL | 178.35 mL |
| 0.5 mM | 3.57 mL | 17.83 mL | 35.67 mL |
| 1 mM | 1.78 mL | 8.92 mL | 17.83 mL |
| 5 mM | 0.36 mL | 1.78 mL | 3.57 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
