DCC-2036 is an orally bioavailable small-molecule inhibitor of multiple tyrosine kinases with potential antineoplastic activity.
Loading distributor info...
| Description | DCC-2036 is an orally bioavailable small-molecule inhibitor of multiple tyrosine kinases with potential antineoplastic activity. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A11200 |
|---|---|
| Formula | C30H28FN7O3 |
| Molecular Weight | 553.59 |
| CAS Number | 1020172-07-9 |
| SMILES | CC(C)(C)C1=NN(C(=C1)NC(=O)NC2=C(C=C(C=C2)OC3=CC(=NC=C3)C(=O)NC)F)C4=CC5=C(C=C4)N=CC=C5 |
| Synonyms | DCC2036 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 103 mg/mL (186.05 mM) | |
| Water | Insoluble | ||
| Ethanol | 15 mg/mL (27.09 mM) | ||
| In vivo | 0.5% CMC+0.25% Tween 80 | 15 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.06 mL | 90.32 mL | 180.64 mL |
| 0.5 mM | 3.61 mL | 18.06 mL | 36.13 mL |
| 1 mM | 1.81 mL | 9.03 mL | 18.06 mL |
| 5 mM | 0.36 mL | 1.81 mL | 3.61 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
