FG-4592 (Roxadustat)
FG-4592 is a novel hypoxia inducible factor prolyl hydroxylase inhibitor, in CKD anemia.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | FG-4592 is a novel hypoxia inducible factor prolyl hydroxylase inhibitor, in CKD anemia. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11237 |
|---|---|
| Formula | C19H16N2O5 |
| Molecular Weight | 352.3 |
| CAS Number | 808118-40-3 |
| SMILES | CC1=NC(=C(C2=C1C=C(C=C2)OC3=CC=CC=C3)O)C(=O)NCC(=O)O |
| Synonyms | FG4592, ASP1517 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 62 mg/mL (175.96 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+40% PEG 300+5% Tween 80+50% ddH2O | 9 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.38 mL | 141.92 mL | 283.85 mL |
| 0.5 mM | 5.68 mL | 28.38 mL | 56.77 mL |
| 1 mM | 2.84 mL | 14.19 mL | 28.38 mL |
| 5 mM | 0.57 mL | 2.84 mL | 5.68 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2