Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GNF-7 is a potent type-II kinase Bcr-Abl inhibitor with IC50 of <5 nM, 61 nM, 122 nM, 136 nM, and 133 nM for M351T, T315I, E255 V, G250E, and c-Abl, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15887 |
|---|---|
| Formula | C28H24F3N7O2 |
| Molecular Weight | 547.53 |
| CAS Number | 839706-07-9 |
| SMILES | O=C(NC1=CC=C(C)C(N2CC3=CN=C(NC4=CC=C(C)N=C4)N=C3N(C)C2=O)=C1)C5=CC=CC(C(F)(F)F)=C5 |
| Synonyms | GNF7, GNF 7 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 17 mg/mL (31.04 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.26 mL | 91.32 mL | 182.64 mL |
| 0.5 mM | 3.65 mL | 18.26 mL | 36.53 mL |
| 1 mM | 1.83 mL | 9.13 mL | 18.26 mL |
| 5 mM | 0.37 mL | 1.83 mL | 3.65 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
