KX2-391 is a novel non-ATP competitive substrate-pocket directed SRC inhibitor.
Loading distributor info...
| Description | KX2-391 is a novel non-ATP competitive substrate-pocket directed SRC inhibitor. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A11177 |
|---|---|
| Formula | C26H29N3O3 |
| Molecular Weight | 431.53 |
| CAS Number | 897016-82-9 |
| SMILES | C1COCCN1CCOC2=CC=C(C=C2)C3=CN=C(C=C3)CC(=O)NCC4=CC=CC=C4 |
| Synonyms | KX2391 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 77 mg/mL (178.43 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 4% DMSO+30% PEG 300+ddH2O | 4 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.17 mL | 115.87 mL | 231.73 mL |
| 0.5 mM | 4.63 mL | 23.17 mL | 46.35 mL |
| 1 mM | 2.32 mL | 11.59 mL | 23.17 mL |
| 5 mM | 0.46 mL | 2.32 mL | 4.63 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
