Loading distributor info...
| Description | NSC59984 induces mutant p53 protein degradation via MDM2 and the ubiquitin-proteasome pathway. The EC50 of NSC59984 in most cancer cells is significantly lower than those of normal cells, with EC50 of 8.38 uM for p53-null HCT116 cells. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13413 |
|---|---|
| Formula | C12H15N3O4 |
| Molecular Weight | 265.27 |
| CAS Number | 803647-40-7 |
| SMILES | CN1CCN(CC1)C(=O)C=CC2=CC=C(O2)[N+](=O)[O-] |
| Synonyms | NSC 59984, NSC-59984 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 48 mg/mL (180.94 mM) | |
| Water | Insoluble | ||
| Ethanol | 48 mg/mL (180.94 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.7 mL | 188.49 mL | 376.97 mL |
| 0.5 mM | 7.54 mL | 37.7 mL | 75.39 mL |
| 1 mM | 3.77 mL | 18.85 mL | 37.7 mL |
| 5 mM | 0.75 mL | 3.77 mL | 7.54 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
