Loading distributor info...
| Description | PP1 is a potent inhibitor of Src-family tyrosine kinases. Inhibits p56lck and p59fynT (IC50 values are 5 and 6 nM respectively). Displays > 8000-fold selectivity over ZAP-70 and JAK2. Also moderately inhibits p38, CSK, PDGF receptors, RET-derived oncoproteins, c-Kit and Bcr-Abl | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A12724 |
|---|---|
| Formula | C16H19N5 |
| Molecular Weight | 281.36 |
| CAS Number | 172889-26-8 |
| SMILES | CC1=CC=C(C=C1)C2=NN(C3=C2C(=NC=N3)N)C(C)(C)C |
| Synonyms | PP-1, PP 1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 4 mg/mL (14.21 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.54 mL | 177.71 mL | 355.42 mL |
| 0.5 mM | 7.11 mL | 35.54 mL | 71.08 mL |
| 1 mM | 3.55 mL | 17.77 mL | 35.54 mL |
| 5 mM | 0.71 mL | 3.55 mL | 7.11 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
