Loading distributor info...
| Description | PP2 is a selective inhibitor of Src-family tyrosine kinases. Inhibits p56lck and p59fynT (IC50 values are 4 and 5 nM respectively). Displays > 10000-fold selectivity over ZAP-70 and JAK2. Moderately inhibits CSK (IC50 = 0.73 μM). | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A12723 |
|---|---|
| Formula | C15H16ClN5 |
| Molecular Weight | 301.78 |
| CAS Number | 172889-27-9 |
| SMILES | CC(C)(C)N1C2=C(C(=N1)C3=CC=C(C=C3)Cl)C(=NC=N2)N |
| Synonyms | PP-2, PP 2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 52 mg/mL (172.31 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (6.62 mM) | ||
| In vivo | 4% DMSO+corn oil | 2.3 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.14 mL | 165.68 mL | 331.37 mL |
| 0.5 mM | 6.63 mL | 33.14 mL | 66.27 mL |
| 1 mM | 3.31 mL | 16.57 mL | 33.14 mL |
| 5 mM | 0.66 mL | 3.31 mL | 6.63 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
