Loading distributor info...
| Description | 6-OAU is a surrogate agonist of GPR84; activates human GPR84 in the presence of Gqi5 chimera in HEK293 cells with an EC50 of 105 nM in the PI assay. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A15507 |
|---|---|
| Formula | C12H21N3O2 |
| Molecular Weight | 239.31 |
| CAS Number | 83797-69-7 |
| SMILES | CCCCCCCCNC1=CC(=O)NC(=O)N1 |
| Synonyms | GTPL5846, 6-n-octylaminouracil |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 33 mg/mL (137.89 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 41.79 mL | 208.93 mL | 417.87 mL |
| 0.5 mM | 8.36 mL | 41.79 mL | 83.57 mL |
| 1 mM | 4.18 mL | 20.89 mL | 41.79 mL |
| 5 mM | 0.84 mL | 4.18 mL | 8.36 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
