Acipimox
Acipimox is a niacin derivative used as a hypolipidemic agent.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | Acipimox is a niacin derivative used as a hypolipidemic agent. |
|---|
| Catalog Num | A10033 |
|---|---|
| Formula | C6H6N2O3 |
| Molecular Weight | 154.1 |
| CAS Number | 51037-30-0 |
| SMILES | CC1=CN=C(C=[N+]1[O-])C(=O)O |
| Synonyms | K-9321, Olbemox, Olbetam |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 29 mg/mL (188.16 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 64.89 mL | 324.46 mL | 648.93 mL |
| 0.5 mM | 12.98 mL | 64.89 mL | 129.79 mL |
| 1 mM | 6.49 mL | 32.45 mL | 64.89 mL |
| 5 mM | 1.3 mL | 6.49 mL | 12.98 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2