Loading distributor info...
| Description | Alosetron is s Serotonin 5HT3-receptor antagonist that is used in treatment of irritable bowel syndrome. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14989 |
|---|---|
| Formula | C17H19ClN4O |
| Molecular Weight | 330.81 |
| CAS Number | 122852-69-1 |
| SMILES | CC1=C(N=CN1)CN2CCC3=C(C2=O)C4=CC=CC=C4N3C.Cl |
| Synonyms | GR 68755C, GR 68755, GR 68755X, Lotronex, GR-68755, GR68755 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 1 mg/mL (3.02 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.23 mL | 151.14 mL | 302.29 mL |
| 0.5 mM | 6.05 mL | 30.23 mL | 60.46 mL |
| 1 mM | 3.02 mL | 15.11 mL | 30.23 mL |
| 5 mM | 0.6 mL | 3.02 mL | 6.05 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
