Loading distributor info...
| Description | Atipamezole HCl is a selective α2-adrenergic receptor antagonist (Ki values are 1.1, 1.0, 0.89, 1300 and 6500 nM for α2A, α2B, α2C, α1A and α1B receptors respectively). Has been shown to be a brain penetrant. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13902 |
|---|---|
| Formula | C14H16N2.HCl |
| Molecular Weight | 248.8 |
| CAS Number | 104075-48-1 |
| SMILES | CCC1(CC2=CC=CC=C2C1)C3=CN=CN3.Cl |
| Synonyms | Antisedan |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 12 mg/mL (48.24 mM) | |
| Water | 21 mg/mL (84.42 mM) | ||
| Ethanol | 48 mg/mL (192.96 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 40.19 mL | 200.96 mL | 401.93 mL |
| 0.5 mM | 8.04 mL | 40.19 mL | 80.39 mL |
| 1 mM | 4.02 mL | 20.1 mL | 40.19 mL |
| 5 mM | 0.8 mL | 4.02 mL | 8.04 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
