Loading distributor info...
| Description | Atomoxetine hydrochloride is a competitive and specific inhibitor of SLC6A2 while demonstrating weak ST and DAT inhibition as studied in synaptosomes of rat hypothalamus. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A13424 |
|---|---|
| Formula | C17H22ClNO |
| Molecular Weight | 291.82 |
| CAS Number | 82248-59-7 |
| SMILES | CC1=CC=CC=C1O[C@H](CCNC)C2=CC=CC=C2.Cl |
| Synonyms | Atomoxetine HCl, LY 139603, LY-139603, Strattera, Tomoxetine hydrochloride |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 51 mg/mL (174.76 mM) | |
| Water | 2 mg/mL (6.85 mM) | ||
| Ethanol | 33 mg/mL (113.08 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.27 mL | 171.34 mL | 342.68 mL |
| 0.5 mM | 6.85 mL | 34.27 mL | 68.54 mL |
| 1 mM | 3.43 mL | 17.13 mL | 34.27 mL |
| 5 mM | 0.69 mL | 3.43 mL | 6.85 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
