Loading distributor info...
| Description | Azithromycin, derived from erythromycin, is a antibiotic. Azithromycin binds to the 50S subunit of the bacterial ribosome, and thus inhibits translation of mRNA. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A15010 |
|---|---|
| Formula | C37H70N2O12 |
| Molecular Weight | 734.96 |
| CAS Number | 76801-85-9 |
| SMILES | CCC1C(C(C(NCC(CC(C(C(C(C(C(=O)O1)C)OC2CC(C(C(O2)C)O)(C)OC)C)OC3C(C(CC(O3)C)N(C)C)O)(C)O)C)C)O)(C)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 50 mg/mL (68.03 mM) | |
| Water | Insoluble | ||
| Ethanol | 99 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 13.61 mL | 68.03 mL | 136.06 mL |
| 0.5 mM | 2.72 mL | 13.61 mL | 27.21 mL |
| 1 mM | 1.36 mL | 6.8 mL | 13.61 mL |
| 5 mM | 0.27 mL | 1.36 mL | 2.72 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
