Benazepril hydrochloride is a non-peptide angiotensin-converting enzyme (ACE) inhibitor. Reduces blood pressure and myocardial hypertrophy in spontaneous hypertensive rats.
Loading distributor info...
| Description | Benazepril hydrochloride is a non-peptide angiotensin-converting enzyme (ACE) inhibitor. Reduces blood pressure and myocardial hypertrophy in spontaneous hypertensive rats. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10123 |
|---|---|
| Formula | C24H28N2O5.HCl |
| Molecular Weight | 461 |
| CAS Number | 86541-74-4 |
| SMILES | CCOC(=O)[C@H](CCC1=CC=CC=C1)N[C@H]2CCC3=CC=CC=C3N(C2=O)CC(=O)O.Cl |
| Synonyms | Lotensin, CGS 14824A |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 81 mg/mL (175.72 mM) | |
| Water | 17 mg/mL (36.87 mM) | ||
| Ethanol | 81 mg/mL (175.72 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.69 mL | 108.46 mL | 216.92 mL |
| 0.5 mM | 4.34 mL | 21.69 mL | 43.38 mL |
| 1 mM | 2.17 mL | 10.85 mL | 21.69 mL |
| 5 mM | 0.43 mL | 2.17 mL | 4.34 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
