Loading distributor info...
| Description | Bioymifi is a potent and selective small molecule agonist of DR5 that directly targets DR5, specifically binds the ECD of DR5 (Kd ~1.2 μM), and induces the formation of DR5 aggregates and DR5 activation. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A12908 |
|---|---|
| Formula | C22H12BrN3O4S |
| Molecular Weight | 494.32 |
| CAS Number | 1420071-30-2 |
| SMILES | C1=CC(=CC=C1N2C(=O)/C(=C/C3=CC=C(O3)C4=CC5=C(C=C4)C(=O)NC5=O)/SC2=N)Br |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 40 mg/mL (80.91 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.23 mL | 101.15 mL | 202.3 mL |
| 0.5 mM | 4.05 mL | 20.23 mL | 40.46 mL |
| 1 mM | 2.02 mL | 10.11 mL | 20.23 mL |
| 5 mM | 0.4 mL | 2.02 mL | 4.05 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
