Loading distributor info...
| Description | BMS303141 is a potent inhibitor of ATP citrate lyase (ACL). BMS303141 inhibits lipid synthesis in HepG2 cells with an IC50 of 8 μM, and lowers plasma triglycerides in a murine hyperlipdemia model. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A13807 |
|---|---|
| Formula | C19H15Cl2NO4S |
| Molecular Weight | 424.3 |
| CAS Number | 943962-47-8 |
| SMILES | COC1=C(C=C(C=C1)C2=CC=CC=C2)NS(=O)(=O)C3=CC(=CC(=C3O)Cl)Cl |
| Synonyms | BMS 303141, BMS-303141 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 73 mg/mL (172.04 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.57 mL | 117.84 mL | 235.68 mL |
| 0.5 mM | 4.71 mL | 23.57 mL | 47.14 mL |
| 1 mM | 2.36 mL | 11.78 mL | 23.57 mL |
| 5 mM | 0.47 mL | 2.36 mL | 4.71 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
