Loading distributor info...
| Description | BX-517 is a potent and selective inhibitor of PDK1 that binds to the ATP binding pocket of the protein (IC50 = 6 nM). |
|---|
| Catalog Num | A12881 |
|---|---|
| Formula | C15H14N4O2 |
| Molecular Weight | 282.3 |
| CAS Number | 850717-64-5 |
| SMILES | CC(=C1C2=C(C=CC(=C2)NC(=O)N)NC1=O)C3=CC=CN3 |
| Synonyms | BX517, BX 517 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 54 mg/mL (191.29 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.42 mL | 177.12 mL | 354.23 mL |
| 0.5 mM | 7.08 mL | 35.42 mL | 70.85 mL |
| 1 mM | 3.54 mL | 17.71 mL | 35.42 mL |
| 5 mM | 0.71 mL | 3.54 mL | 7.08 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
