Loading distributor info...
| Description | Carbidopa inhibits aromatic-L-amino-acid decarboxylase, an enzyme important in the biosynthesis of L-tryptophan to serotonin and in the biosynthesis of L-DOPA to Dopamine (DA). |
|---|
| Catalog Num | A10181 |
|---|---|
| Formula | C10H14N2O4 |
| Molecular Weight | 226.2 |
| CAS Number | 28860-95-9 |
| SMILES | C[C@](CC1=CC(=C(C=C1)O)O)(C(=O)O)NN |
| Synonyms | Lodosyn |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 3 mg/mL (13.26 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 4% DMSO+30% PEG 300+2% Tween 80+ddH2O | 1 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 44.21 mL | 221.04 mL | 442.09 mL |
| 0.5 mM | 8.84 mL | 44.21 mL | 88.42 mL |
| 1 mM | 4.42 mL | 22.1 mL | 44.21 mL |
| 5 mM | 0.88 mL | 4.42 mL | 8.84 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
