Loading distributor info...
| Description | Chlorpromazine is a dopamine antagonist of the typical antipsychotic class of medications possessing additional antiadrenergic, antiserotonergic, anticholinergic and antihistaminergic properties used to treat schizophrenia. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10206 |
|---|---|
| Formula | C17H19ClN2S.HCl |
| Molecular Weight | 355.33 |
| CAS Number | 69-09-0 |
| SMILES | CN(C)CCCN1C2=CC=CC=C2SC3=C1C=C(C=C3)Cl.Cl |
| Synonyms | CPZ, Largactil |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 60 mg/mL (168.85 mM) | |
| Water | 60 mg/mL (168.85 mM) | ||
| Ethanol | 60 mg/mL (168.85 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.14 mL | 140.71 mL | 281.43 mL |
| 0.5 mM | 5.63 mL | 28.14 mL | 56.29 mL |
| 1 mM | 2.81 mL | 14.07 mL | 28.14 mL |
| 5 mM | 0.56 mL | 2.81 mL | 5.63 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
