Loading distributor info...
| Description | Cilostamide is a selective inhibitor of phosphodiesterase (PDE)3A and PDE3B with IC50 values of 27 and 50 nM, respectively. |
|---|
| Catalog Num | A13596 |
|---|---|
| Formula | C20H26N2O3 |
| Molecular Weight | 342.4 |
| CAS Number | 68550-75-4 |
| SMILES | CN(C1CCCCC1)C(=O)CCCOC2=CC3=C(C=C2)NC(=O)C=C3 |
| Synonyms | OPC 3689 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 5 mg/mL (14.6 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.21 mL | 146.03 mL | 292.06 mL |
| 0.5 mM | 5.84 mL | 29.21 mL | 58.41 mL |
| 1 mM | 2.92 mL | 14.6 mL | 29.21 mL |
| 5 mM | 0.58 mL | 2.92 mL | 5.84 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
