Loading distributor info...
| Description | CL-387785 is an irreversible inhibitor of EGFR with IC50 of 370+/-120 pM; is able to overcome resistance caused by the T790M mutation on a functional level. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A13146 |
|---|---|
| Formula | C18H13BrN4O |
| Molecular Weight | 381.23 |
| CAS Number | 194423-06-8 |
| SMILES | CC#C/C(O)=N/C1=CC(C(NC2=CC=CC(Br)=C2)=NC=N3)=C3C=C1 |
| Synonyms | WAY-EKI 785, CL387785, CL 387785, EKI785, WAY-EKI785, EKI 785, EKI-785 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 61 mg/mL (160 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.23 mL | 131.15 mL | 262.31 mL |
| 0.5 mM | 5.25 mL | 26.23 mL | 52.46 mL |
| 1 mM | 2.62 mL | 13.12 mL | 26.23 mL |
| 5 mM | 0.52 mL | 2.62 mL | 5.25 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
