Loading distributor info...
| Description | Nucleoside analog that acts as an anticancer and antifungal agent. Can be converted to 3'-deoxyadenosine triphosphate (3'-dATP), which inhibits ATP-dependent DNA synthesis. Inhibits growth of various tumor cells in vitro. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A12033 |
|---|---|
| Formula | C10H13N5O3 |
| Molecular Weight | 251.24 |
| CAS Number | 73-03-0 |
| SMILES | C1[C@H](O[C@H]([C@@H]1O)N2C=NC3=C2N=CN=C3N)CO |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 45 mg/mL (179.11 mM) | |
| Water | 22 mg/mL (87.56 mM) | ||
| Ethanol | 1 mg/mL (3.98 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 39.8 mL | 199.01 mL | 398.03 mL |
| 0.5 mM | 7.96 mL | 39.8 mL | 79.61 mL |
| 1 mM | 3.98 mL | 19.9 mL | 39.8 mL |
| 5 mM | 0.8 mL | 3.98 mL | 7.96 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
