histamine receptor antagonist
Loading distributor info...
| Description | Cyproheptadine hydrochloride is a histamine receptor antagonist for 5-HT2 receptor with IC50 of 0.6 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11709 |
|---|---|
| Formula | C21H21N.HCl |
| Molecular Weight | 323.86 |
| CAS Number | 969-33-5 |
| SMILES | CN1CCC(=C2C3=CC=CC=C3C=CC4=CC=CC=C42)CC1.Cl |
| Synonyms | Periactin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 62 mg/mL (191.44 mM) | |
| Water | Insoluble | ||
| Ethanol | 19 mg/mL (58.66 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.88 mL | 154.39 mL | 308.78 mL |
| 0.5 mM | 6.18 mL | 30.88 mL | 61.76 mL |
| 1 mM | 3.09 mL | 15.44 mL | 30.88 mL |
| 5 mM | 0.62 mL | 3.09 mL | 6.18 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
