Loading distributor info...
| Description | Dapagliflozin inhibits subtype 2 of the sodium-glucose transport proteins (SGLT2), which is responsible for at least 90% of the glucose reabsorption in the kidney. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A10285 |
|---|---|
| Formula | C21H25ClO6 |
| Molecular Weight | 408.9 |
| CAS Number | 461432-26-8 |
| SMILES | CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 75 mg/mL (183.43 mM) | |
| Water | Insoluble | ||
| Ethanol | 15 mg/mL (36.68 mM) | ||
| In vivo | 5% DMSO+40%PEG300+5% tween80+50% H2O | 3.8 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.46 mL | 122.28 mL | 244.56 mL |
| 0.5 mM | 4.89 mL | 24.46 mL | 48.91 mL |
| 1 mM | 2.45 mL | 12.23 mL | 24.46 mL |
| 5 mM | 0.49 mL | 2.45 mL | 4.89 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
