Loading distributor info...
| Description | Disodium (R)-2-Hydroxyglutarate is a competitive inhibitor of ??-ketoglutarate-dependent dioxygenases with Ki of 0.628 mM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12901 |
|---|---|
| Formula | C5H6Na2O5 |
| Molecular Weight | 192.08 |
| CAS Number | 103404-90-6 |
| SMILES | [O-]C(CC[C@@H](O)C([O-])=O)=O.[Na+].[Na+] |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | Warmed: 36 mg/mL (187.42 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 52.06 mL | 260.31 mL | 520.62 mL |
| 0.5 mM | 10.41 mL | 52.06 mL | 104.12 mL |
| 1 mM | 5.21 mL | 26.03 mL | 52.06 mL |
| 5 mM | 1.04 mL | 5.21 mL | 10.41 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
