Loading distributor info...
| Description | Etidronic acid is a bisphosphonate used to strengthen bone, treat osteoporosis, and treat Paget's disease of bone. An etidronate is a salt of etidronic acid, abbeviated MnHEDP. Etidronate, unlike other bisphosphonates, also prevents bone calcification. |
|---|
| Catalog Num | A11684 |
|---|---|
| Formula | C2H8O7P2 |
| Molecular Weight | 206.03 |
| CAS Number | 2809-21-4 |
| SMILES | CC(O)(P(=O)(O)O)P(=O)(O)O |
| Synonyms | HEDP, Etidronic acid |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 35 mg/mL (169.88 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 48.54 mL | 242.68 mL | 485.37 mL |
| 0.5 mM | 9.71 mL | 48.54 mL | 97.07 mL |
| 1 mM | 4.85 mL | 24.27 mL | 48.54 mL |
| 5 mM | 0.97 mL | 4.85 mL | 9.71 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
