Loading distributor info...
| Description | Formoterol is a long-acting β2-agonist used in the management of asthma and/or chronic obstructive pulmonary disease (COPD). |
|---|
| Catalog Num | A11732 |
|---|---|
| Formula | C19H24N2O4.1/2C4H4O4 |
| Molecular Weight | 402.4 |
| CAS Number | 43229-80-7 |
| SMILES | C[C@@H](CC1=CC=C(C=C1)OC)NC[C@H](C2=CC(=C(C=C2)O)NC=O)O.C[C@@H](CC1=CC=C(C=C1)OC)NC[C@H](C2=CC(=C(C=C2)O)NC=O)O.C(=C/C(=O)O)\C(=O)O |
| Synonyms | eformoterol |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 70 mg/mL (173.95 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.85 mL | 124.25 mL | 248.51 mL |
| 0.5 mM | 4.97 mL | 24.85 mL | 49.7 mL |
| 1 mM | 2.49 mL | 12.43 mL | 24.85 mL |
| 5 mM | 0.5 mL | 2.49 mL | 4.97 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
