Granisetron Hydrochloride
Catalog No.: A10437
5-HT3 receptor antagonist
Granisetron HCl is a serotonin 5-HT3 receptor antagonist
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | Granisetron HCl is a serotonin 5-HT3 receptor antagonist | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10437 |
|---|---|
| Formula | C18H24N4O.HCl |
| Molecular Weight | 348.87 |
| CAS Number | 107007-99-8 |
| SMILES | CN1C2CCCC1CC(C2)NC(=O)C3=NN(C4=CC=CC=C43)C.Cl |
| Synonyms | Kytril |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 1 mg/mL (2.86 mM) | |
| Water | 67 mg/mL (192.05 mM) | ||
| Ethanol | 1 mg/mL (2.86 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.66 mL | 143.32 mL | 286.64 mL |
| 0.5 mM | 5.73 mL | 28.66 mL | 57.33 mL |
| 1 mM | 2.87 mL | 14.33 mL | 28.66 mL |
| 5 mM | 0.57 mL | 2.87 mL | 5.73 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2