Loading distributor info...
| Description | Hydralazine hydrochloride is a hydrochloride salt of hydralazine (Apresoline) that is a direct-acting smooth muscle relaxant with an IC50 of 1.9 mM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10455 |
|---|---|
| Formula | C8H8N4.HCl |
| Molecular Weight | 196.64 |
| CAS Number | 304-20-1 |
| SMILES | C1=CC=C2C(=C1)C=NN=C2NN.Cl |
| Synonyms | Apresoline |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 1 mg/mL (5.08 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 50.85 mL | 254.27 mL | 508.54 mL |
| 0.5 mM | 10.17 mL | 50.85 mL | 101.71 mL |
| 1 mM | 5.09 mL | 25.43 mL | 50.85 mL |
| 5 mM | 1.02 mL | 5.09 mL | 10.17 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
