Loading distributor info...
| Description | Ibudilast, a pharmacologic phosphodiesterase inhibitor, prevents human immunodeficiency Virus-1 Tat-Mediated activation of microglial cells. |
|---|
| Catalog Num | A11019 |
|---|---|
| Formula | C14H18N2O |
| Molecular Weight | 230.3 |
| CAS Number | 50847-11-5 |
| SMILES | CC(C)C1=NN2C=CC=CC2=C1C(=O)C(C)C |
| Synonyms | KC-404 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 39 mg/mL (169.34 mM) | |
| Water | 26 mg/mL (112.88 mM) | ||
| Ethanol | 39 mg/mL (169.34 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 43.42 mL | 217.11 mL | 434.22 mL |
| 0.5 mM | 8.68 mL | 43.42 mL | 86.84 mL |
| 1 mM | 4.34 mL | 21.71 mL | 43.42 mL |
| 5 mM | 0.87 mL | 4.34 mL | 8.68 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
