Laquinimod (ABR-215062)
Catalog No.: A11128
Laquinimod (ABR-215062) is a potent immunomodulator.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | Laquinimod (ABR-215062) is a potent immunomodulator. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11128 |
|---|---|
| Formula | C19H17ClN2O3 |
| Molecular Weight | 356.8 |
| CAS Number | 248281-84-7 |
| SMILES | CCN(C1=CC=CC=C1)C(=O)C2=C(C3=C(C=CC=C3Cl)N(C2=O)C)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 60 mg/mL (168.16 mM) | |
| Water | Insoluble | ||
| Ethanol | 1 mg/mL (2.8 mM) | ||
| In vivo | 30% propylene glycol, 5% Tween 80, 65% D5W | 28 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.03 mL | 140.13 mL | 280.27 mL |
| 0.5 mM | 5.61 mL | 28.03 mL | 56.05 mL |
| 1 mM | 2.8 mL | 14.01 mL | 28.03 mL |
| 5 mM | 0.56 mL | 2.8 mL | 5.61 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2