Loading distributor info...
| Description | Lerisetron is a serotonin type 3 (5-HT3) receptor antagonist with antiemetic activity. |
|---|
| Catalog Num | A15501 |
|---|---|
| Formula | C18H20N4 |
| Molecular Weight | 292.38 |
| CAS Number | 143257-98-1 |
| SMILES | C1CN(CCN1)C2=NC3=CC=CC=C3N2CC4=CC=CC=C4 |
| Synonyms | F-0930-RS |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 55 mg/mL (188.11 mM) | |
| Water | Insoluble | ||
| Ethanol | 55 mg/mL (188.11 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.2 mL | 171.01 mL | 342.02 mL |
| 0.5 mM | 6.84 mL | 34.2 mL | 68.4 mL |
| 1 mM | 3.42 mL | 17.1 mL | 34.2 mL |
| 5 mM | 0.68 mL | 3.42 mL | 6.84 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
