Loading distributor info...
| Description | Lesinurad is a selective uric acid re-absorption inhibitor (SURI) and is also a selective inhibitor of URAT1, a transporter in the kidney that regulates uric acid excretion from the body. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A12981 |
|---|---|
| Formula | C17H14BrN3O2S |
| Molecular Weight | 404.28 |
| CAS Number | 878672-00-5 |
| SMILES | C1CC1C2=CC=C(C3=CC=CC=C23)N4C(=NN=C4Br)SCC(=O)O |
| Synonyms | RDEA594, RDEA 594, RDEA-594 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 72 mg/mL (178.09 mM) | |
| Water | Insoluble | ||
| Ethanol | 49 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.74 mL | 123.68 mL | 247.35 mL |
| 0.5 mM | 4.95 mL | 24.74 mL | 49.47 mL |
| 1 mM | 2.47 mL | 12.37 mL | 24.74 mL |
| 5 mM | 0.49 mL | 2.47 mL | 4.95 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
